Difference between revisions of "PYRUVATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == * smiles: ** CC(C(=O)[O-])C(O)C([O-])=O * inchi key: ** InChIKey=NPYQJIHH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] == * smiles: ** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O * inchi key...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L |
* common name: | * common name: | ||
− | ** | + | ** EDTA |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 290.229 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ethylenediaminetetraacetic acid |
− | ** | + | ** ethylenediaminetetraacetate |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[TransportSeed_EDTA]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[TransportSeed_EDTA]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[ExchangeSeed_EDTA]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201827 25201827] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42191 42191] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00284 C00284] |
− | {{#set: smiles= | + | * HMDB : HMDB15109 |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L}} |
− | {{#set: molecular weight= | + | {{#set: common name=EDTA}} |
− | {{#set: common name= | + | {{#set: molecular weight=290.229 }} |
− | {{#set: consumed by= | + | {{#set: common name=ethylenediaminetetraacetic acid|ethylenediaminetetraacetate}} |
+ | {{#set: consumed by=TransportSeed_EDTA}} | ||
+ | {{#set: produced by=TransportSeed_EDTA}} | ||
+ | {{#set: reversible reaction associated=ExchangeSeed_EDTA}} |
Revision as of 13:43, 21 March 2018
Contents
Metabolite EDTA
- smiles:
- C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O
- inchi key:
- InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L
- common name:
- EDTA
- molecular weight:
- 290.229
- Synonym(s):
- ethylenediaminetetraacetic acid
- ethylenediaminetetraacetate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O" cannot be used as a page name in this wiki.