Difference between revisions of "3-oxo-cis-D7-tetradecenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-11_005510 == * left end position: ** 5511573 * transcription direction: ** POSITIVE * right end position: ** 5516739 * centisome position: ** 87.6...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMNH2 FMNH2] == * smiles: ** CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-11_005510 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMNH2 FMNH2] ==
−
* left end position:
+
* smiles:
−
** 5511573
+
** CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3)))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=YTNIXZGTHTVJBW-SCRDCRAPSA-L
−
* right end position:
+
* common name:
−
** 5516739
+
** FMNH2
−
* centisome position:
+
* molecular weight:
−
** 87.62914    
+
** 456.348    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0031_0033
+
** Reduced FMN
−
** Esi0031_0033
+
** reduced flavin mononucleotide
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[GDPMANDEHYDRA-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN-9510]]
−
***go-term
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways associated ==
+
−
* [[GDPRHAMSYN-PWY]]
+
−
* [[PWY-66]]
+
−
* [[PWY-5740]]
+
−
* [[PWY-7573]]
+
−
* [[PWY-5738]]
+
−
* [[PWY-5739]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=5511573}}
+
* CAS : 5666-16-0
−
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
−
{{#set: right end position=5516739}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229161 44229161]
−
{{#set: centisome position=87.62914   }}
+
* HMDB : HMDB01142
−
{{#set: common name=Esi_0031_0033|Esi0031_0033}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=GDPMANDEHYDRA-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01847 C01847]
−
{{#set: pathway associated=GDPRHAMSYN-PWY|PWY-66|PWY-5740|PWY-7573|PWY-5738|PWY-5739}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57618 57618]
 +
* BIGG : 1489679
 +
{{#set: smiles=CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3)))}}
 +
{{#set: inchi key=InChIKey=YTNIXZGTHTVJBW-SCRDCRAPSA-L}}
 +
{{#set: common name=FMNH2}}
 +
{{#set: molecular weight=456.348   }}
 +
{{#set: common name=Reduced FMN|reduced flavin mononucleotide}}
 +
{{#set: produced by=RXN-9510}}

Revision as of 13:43, 21 March 2018

Metabolite FMNH2

  • smiles:
    • CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3)))
  • inchi key:
    • InChIKey=YTNIXZGTHTVJBW-SCRDCRAPSA-L
  • common name:
    • FMNH2
  • molecular weight:
    • 456.348
  • Synonym(s):
    • Reduced FMN
    • reduced flavin mononucleotide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 5666-16-0
  • PUBCHEM:
  • HMDB : HMDB01142
  • LIGAND-CPD:
  • CHEBI:
  • BIGG : 1489679
"CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3-oxo-cis-D7-tetradecenoyl-ACPs&oldid=21096"