Difference between revisions of "RXN-1602"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] == * smiles: ** C(OP([O-])(=O)[O-])C([O-])=O * inchi key: ** InChIKey=ASCFNMCAHF...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMINEOXID-RXN AMINEOXID-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Aliphatic-amine oxi...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMINEOXID-RXN AMINEOXID-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Aliphatic-amine oxidase |
− | * | + | ** primary amine oxidase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/1.4.3.21 EC-1.4.3.21] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[WATER]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[Aliphatic-Amines]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[Aldehydes]][c] '''+''' 1 [[AMMONIUM]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 H2O[c] '''+''' 1 oxygen[c] '''+''' 1 an aliphatic amine[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 an aldehyde[c] '''+''' 1 ammonium[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-15_002910]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-15_002920]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16153 16153] |
− | ** [http:// | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/Q7M2P5 Q7M2P5] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9TRK6 Q9TRK6] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q07123 Q07123] |
− | * | + | ** [http://www.uniprot.org/uniprot/P19801 P19801] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q29437 Q29437] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q59118 Q59118] |
− | + | ** [http://www.uniprot.org/uniprot/Q9TRK5 Q9TRK5] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9TRC7 Q9TRC7] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q43077 Q43077] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P46883 P46883] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q16853 Q16853] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9SXW5 Q9SXW5] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P12807 P12807] |
+ | ** [http://www.uniprot.org/uniprot/P49252 P49252] | ||
+ | ** [http://www.uniprot.org/uniprot/P36633 P36633] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M504 Q7M504] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=Aliphatic-amine oxidase}} | ||
+ | {{#set: common name=primary amine oxidase}} | ||
+ | {{#set: ec number=EC-1.4.3.21}} | ||
+ | {{#set: gene associated=Ec-15_002910|Ec-15_002920}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 13:44, 21 March 2018
Contents
Reaction AMINEOXID-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Aliphatic-amine oxidase
- primary amine oxidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 OXYGEN-MOLECULE[c] + 1 Aliphatic-Amines[c] => 1 HYDROGEN-PEROXIDE[c] + 1 Aldehydes[c] + 1 AMMONIUM[c]
- With common name(s):
- 1 H2O[c] + 1 oxygen[c] + 1 an aliphatic amine[c] => 1 hydrogen peroxide[c] + 1 an aldehyde[c] + 1 ammonium[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-15_002910
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-15_002920
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- UNIPROT: