Difference between revisions of "Ec-13 004490"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] == * smiles: ** CC(=O)C1(C=CC=CC=1) * inchi key: ** InChIKey=KWOLFJPFCHCOCG-UHFF...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11026 RXN-11026] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-CoA oxidase, partial *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11026 RXN-11026] ==
−
* smiles:
+
* direction:
−
** CC(=O)C1(C=CC=CC=1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** acetophenone
+
** acyl-CoA oxidase, partial
−
* molecular weight:
+
** acyl-CoA oxidase
−
** 120.151   
+
** Acyl-CoA oxidase/dehydrogenase, central domain
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6]
 
* Synonym(s):
 
* Synonym(s):
−
** phenylmethylketone
 
−
** methylphenylketone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[Saturated-Fatty-Acyl-CoA]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[TRANS-D2-ENOYL-COA]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
−
* [[RXN-1302]]
+
* With common name(s):
 +
** 1 a 2,3,4-saturated fatty acyl CoA[c] '''+''' 1 oxygen[c] '''=>''' 1 a trans-2-enoyl-CoA[c] '''+''' 1 hydrogen peroxide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-22_002920]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-08_006390]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Ec-26_004320]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5136]], fatty acid β-oxidation II (peroxisome): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5136 PWY-5136]
 +
** '''4''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-7288]], fatty acid β-oxidation (peroxisome, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7288 PWY-7288]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY66-391]], fatty acid β-oxidation VI (peroxisome): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-391 PWY66-391]
 +
** '''4''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 98-86-2
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* DRUGBANK : DB04619
+
{{#set: common name=acyl-CoA oxidase, partial}}
−
* PUBCHEM:
+
{{#set: common name=acyl-CoA oxidase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7410 7410]
+
{{#set: common name=Acyl-CoA oxidase/dehydrogenase, central domain}}
−
* HMDB : HMDB33910
+
{{#set: ec number=EC-1.3.3.6}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-22_002920|Ec-08_006390|Ec-26_004320}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C07113 C07113]
+
{{#set: in pathway=PWY-5136|PWY-7288|PWY66-391}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.7132.html 7132]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27632 27632]
+
−
{{#set: smiles=CC(=O)C1(C=CC=CC=1)}}
+
−
{{#set: inchi key=InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N}}
+
−
{{#set: common name=acetophenone}}
+
−
{{#set: molecular weight=120.151    }}
+
−
{{#set: common name=phenylmethylketone|methylphenylketone}}
+
−
{{#set: reversible reaction associated=RXN-1302}}
+

Revision as of 13:44, 21 March 2018

Reaction RXN-11026

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acyl-CoA oxidase, partial
    • acyl-CoA oxidase
    • Acyl-CoA oxidase/dehydrogenase, central domain
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5136, fatty acid β-oxidation II (peroxisome): PWY-5136
    • 4 reactions found over 5 reactions in the full pathway
  • PWY-7288, fatty acid β-oxidation (peroxisome, yeast): PWY-7288
    • 2 reactions found over 5 reactions in the full pathway
  • PWY66-391, fatty acid β-oxidation VI (peroxisome): PWY66-391
    • 4 reactions found over 7 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-13_004490&oldid=21208"