Difference between revisions of "INORGPYROPHOSPHAT-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-308 RXN0-308] == * direction: ** LEFT-TO-RIGHT * common name: ** Aminotransferase class V doma...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] == * smiles: ** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-308 RXN0-308] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
 +
* inchi key:
 +
** InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J
 
* common name:
 
* common name:
−
** Aminotransferase class V domain
+
** 5-hydroxy-CTP
−
** Cysteine desulfurase
+
* molecular weight:
−
* ec number:
+
** 495.126   
−
** [http://enzyme.expasy.org/EC/2.8.1.7 EC-2.8.1.7]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-hydroxycytidine triphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CYS]][c] '''+''' 1 [[Cysteine-Desulfurase-L-cysteine]][c] '''=>''' 1 [[L-Cysteine-Desulfurase-persulfide]][c] '''+''' 1 [[L-ALPHA-ALANINE]][c]
+
* [[RXN0-7080]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 L-cysteine[c] '''+''' 1 an [L-cysteine desulfurase]-L-cysteine[c] '''=>''' 1 an [L-cysteine desulfurase] L-cysteine persulfide[c] '''+''' 1 L-alanine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-21_003740]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-22_000950]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-21_005640]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY0-1021]], L-alanine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1021 PWY0-1021]
+
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
−
* [[PWY-6823]], molybdenum cofactor biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6823 PWY-6823]
+
−
** '''7''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-6891]], thiazole biosynthesis II (aerobic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6891 PWY-6891]
+
−
** '''2''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-6892]], thiazole biosynthesis I (facultative anaerobic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6892 PWY-6892]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R07460 R07460]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202584 25202584]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O}}
−
{{#set: common name=Aminotransferase class V domain}}
+
{{#set: inchi key=InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J}}
−
{{#set: common name=Cysteine desulfurase}}
+
{{#set: common name=5-hydroxy-CTP}}
−
{{#set: ec number=EC-2.8.1.7}}
+
{{#set: molecular weight=495.126    }}
−
{{#set: gene associated=Ec-21_003740|Ec-22_000950|Ec-21_005640}}
+
{{#set: common name=5-hydroxycytidine triphosphate}}
−
{{#set: in pathway=PWY0-1021|PWY-6823|PWY-6891|PWY-6892}}
+
{{#set: produced by=RXN0-7080}}
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Revision as of 13:44, 21 March 2018

Metabolite 5-HYDROXY-CTP

  • smiles:
    • C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
  • inchi key:
    • InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J
  • common name:
    • 5-hydroxy-CTP
  • molecular weight:
    • 495.126
  • Synonym(s):
    • 5-hydroxycytidine triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=INORGPYROPHOSPHAT-RXN&oldid=21233"