Difference between revisions of "RXN-15200"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-02_006310 == * left end position: ** 6415550 * transcription direction: ** NEGATIVE * right end position: ** 6427020 * centisome position: ** 98.2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] == * smiles: ** C(=O)([O-])C(=O)CC(O)CCl * inchi key: ** InChIKey=FHWPHVIG...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(=O)([O-])C(=O)CC(O)CCl |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M |
| − | * | + | * common name: |
| − | ** | + | ** 5-chloro-4-hydroxy-2-oxopentanoate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 165.553 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 5-chloro-4-hydroxy-2-oxovalerate |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-11717]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[RXN- | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859580 49859580] |
| − | {{#set: | + | {{#set: smiles=C(=O)([O-])C(=O)CC(O)CCl}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M}} |
| − | {{#set: common name= | + | {{#set: common name=5-chloro-4-hydroxy-2-oxopentanoate}} |
| − | + | {{#set: molecular weight=165.553 }} | |
| − | {{#set: | + | {{#set: common name=5-chloro-4-hydroxy-2-oxovalerate}} |
| + | {{#set: produced by=RXN-11717}} | ||
Revision as of 13:44, 21 March 2018
Contents
Metabolite CPD-11020
- smiles:
- C(=O)([O-])C(=O)CC(O)CCl
- inchi key:
- InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M
- common name:
- 5-chloro-4-hydroxy-2-oxopentanoate
- molecular weight:
- 165.553
- Synonym(s):
- 5-chloro-4-hydroxy-2-oxovalerate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])C(=O)CC(O)CCl" cannot be used as a page name in this wiki.
