Difference between revisions of "Ec-12 000230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] == * smiles: ** C(=O)([O-])C(=O)CC(O)CCl * inchi key: ** InChIKey=FHWPHVIG...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14480 RXN-14480] == * direction: ** REVERSIBLE * common name: ** tRNA-i(6)A37 thiotransferase e...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14480 RXN-14480] ==
* smiles:
+
* direction:
** C(=O)([O-])C(=O)CC(O)CCl
+
** REVERSIBLE
* inchi key:
+
** InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M
+
 
* common name:
 
* common name:
** 5-chloro-4-hydroxy-2-oxopentanoate
+
** tRNA-i(6)A37 thiotransferase enzyme MiaB
* molecular weight:
+
** 165.553   
+
 
* Synonym(s):
 
* Synonym(s):
** 5-chloro-4-hydroxy-2-oxovalerate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-11717]]
+
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[Donor-H2]][c] '''+''' 1 [[6-Dimethylallyladenosine37-tRNAs]][c] '''+''' 1 [[Sulfurated-Sulfur-Acceptors]][c] '''<=>''' 1 [[Acceptor]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CH33ADO]][c] '''+''' 1 [[MET]][c] '''+''' 1 [[Unsulfurated-Sulfur-Acceptors]][c] '''+''' 1 [[CPD-15360]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 S-adenosyl-L-methionine[c] '''+''' 1 an reduced unknown electron acceptor[c] '''+''' 1 N6-dimethylallyladenosine37 in tRNA[c] '''+''' 1 a sulfurated [sulfur carrier][c] '''<=>''' 1 an oxidized unknown electron acceptor[c] '''+''' 1 H+[c] '''+''' 1 5'-deoxyadenosine[c] '''+''' 1 L-methionine[c] '''+''' 1 an unsulfurated [sulfur carrier][c] '''+''' 1 2-thio-N6-dimethylallyladenosine37 in tRNA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-02_004930]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859580 49859580]
+
{{#set: common name=tRNA-i(6)A37 thiotransferase enzyme MiaB}}
{{#set: smiles=C(=O)([O-])C(=O)CC(O)CCl}}
+
{{#set: gene associated=Ec-02_004930}}
{{#set: inchi key=InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M}}
+
{{#set: in pathway=}}
{{#set: common name=5-chloro-4-hydroxy-2-oxopentanoate}}
+
{{#set: reconstruction category=annotation}}
{{#set: molecular weight=165.553    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: common name=5-chloro-4-hydroxy-2-oxovalerate}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: produced by=RXN-11717}}
+

Revision as of 13:44, 21 March 2018

Reaction RXN-14480

  • direction:
    • REVERSIBLE
  • common name:
    • tRNA-i(6)A37 thiotransferase enzyme MiaB
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links