Difference between revisions of "CPD-17368"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1083 CPD0-1083] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)O * inchi key: ** InChIKey=RGH...")
 
(Created page with "Category:Gene == Gene Ec-03_000770 == * Synonym(s): ** Esi_0027_0032 ** Esi0027_0032 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1083 CPD0-1083] ==
+
== Gene Ec-03_000770 ==
* smiles:
+
** C(C(C(C(C(C([O-])=O)O)O)O)O)O
+
* inchi key:
+
** InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M
+
* common name:
+
** aldehydo-L-galactonate
+
* molecular weight:
+
** 195.149   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0027_0032
 +
** Esi0027_0032
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[RXN-8443]]
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[aragem]]
* [[RXN-11152]]
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0027_0032|Esi0027_0032}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229140 44229140]
+
{{#set: reaction associated=RXN-8443}}
* CHEBI:
+
{{#set: pathway associated=PWY-5381}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53071 53071]
+
* BIGG : 3138483
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?c15930 c15930]
+
{{#set: smiles=C(C(C(C(C(C([O-])=O)O)O)O)O)O}}
+
{{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M}}
+
{{#set: common name=aldehydo-L-galactonate}}
+
{{#set: molecular weight=195.149    }}
+
{{#set: consumed or produced by=RXN-11152}}
+

Revision as of 20:42, 17 March 2018

Gene Ec-03_000770

  • Synonym(s):
    • Esi_0027_0032
    • Esi0027_0032

Reactions associated

Pathways associated

External links