Difference between revisions of "CPD-11020"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] == * smiles: ** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2)) * inc...") |
(Created page with "Category:Gene == Gene Ec-10_003770 == * left end position: ** 3818570 * transcription direction: ** POSITIVE * right end position: ** 3827446 * centisome position: ** 58.7...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-10_003770 == |
− | * | + | * left end position: |
− | ** | + | ** 3818570 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3827446 |
− | * | + | * centisome position: |
− | ** | + | ** 58.738327 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0032_0010 |
− | ** | + | ** Esi0032_0010 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ATPASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3818570}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3827446}} | |
− | + | {{#set: centisome position=58.738327 }} | |
− | + | {{#set: common name=Esi_0032_0010|Esi0032_0010}} | |
− | {{#set: | + | {{#set: reaction associated=ATPASE-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 14:45, 21 March 2018
Gene Ec-10_003770
- left end position:
- 3818570
- transcription direction:
- POSITIVE
- right end position:
- 3827446
- centisome position:
- 58.738327
- Synonym(s):
- Esi_0032_0010
- Esi0032_0010
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome