Difference between revisions of "RXN-17253"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10462 RXN-10462] == * direction: ** LEFT-TO-RIGHT * common name: ** Glycerol-3-phosphate O-acyl...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] == * smiles: ** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2)) * inc...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10462 RXN-10462] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))
 +
* inchi key:
 +
** InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** Glycerol-3-phosphate O-acyltransferase
+
** 6-sulfatoxymelatonin
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.1.15 EC-2.3.1.15]
+
** 327.331   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6-sulphatoxymelatonin
 +
** 6-hydroxymelatoninsulfate
 +
** 6-hydroxymelatonin sulfate ester
 +
** acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ACYL-ACP]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''=>''' 1 [[ACYL-SN-GLYCEROL-3P]][c] '''+''' 1 [[ACP]][c]
+
* [[RXN-11058]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 an acyl-[acyl-carrier protein][c] '''+''' 1 sn-glycerol 3-phosphate[c] '''=>''' 1 a 1-acyl-sn-glycerol 3-phosphate[c] '''+''' 1 a holo-[acyl-carrier protein][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_003960]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY0-1319]], CDP-diacylglycerol biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1319 PWY0-1319]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R09380 R09380]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65096 65096]
−
* UNIPROT:
+
* CHEMSPIDER:
−
** [http://www.uniprot.org/uniprot/P0A7A7 P0A7A7]
+
** [http://www.chemspider.com/Chemical-Structure.58606.html 58606]
−
** [http://www.uniprot.org/uniprot/Q43822 Q43822]
+
* HMDB : HMDB41815
−
** [http://www.uniprot.org/uniprot/Q39639 Q39639]
+
{{#set: smiles=CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))}}
−
** [http://www.uniprot.org/uniprot/Q39317 Q39317]
+
{{#set: inchi key=InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M}}
−
** [http://www.uniprot.org/uniprot/Q8LG50 Q8LG50]
+
{{#set: common name=6-sulfatoxymelatonin}}
−
** [http://www.uniprot.org/uniprot/Q43869 Q43869]
+
{{#set: molecular weight=327.331    }}
−
** [http://www.uniprot.org/uniprot/Q43307 Q43307]
+
{{#set: common name=6-sulphatoxymelatonin|6-hydroxymelatoninsulfate|6-hydroxymelatonin sulfate ester|acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-}}
−
** [http://www.uniprot.org/uniprot/P30706 P30706]
+
{{#set: produced by=RXN-11058}}
−
** [http://www.uniprot.org/uniprot/P10349 P10349]
+
−
** [http://www.uniprot.org/uniprot/P44857 P44857]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: common name=Glycerol-3-phosphate O-acyltransferase}}
+
−
{{#set: ec number=EC-2.3.1.15}}
+
−
{{#set: gene associated=Ec-01_003960}}
+
−
{{#set: in pathway=PWY0-1319}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Revision as of 13:45, 21 March 2018

Metabolite CPD-12015

  • smiles:
    • CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))
  • inchi key:
    • InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M
  • common name:
    • 6-sulfatoxymelatonin
  • molecular weight:
    • 327.331
  • Synonym(s):
    • 6-sulphatoxymelatonin
    • 6-hydroxymelatoninsulfate
    • 6-hydroxymelatonin sulfate ester
    • acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • CHEMSPIDER:
  • HMDB : HMDB41815
"CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-17253&oldid=21289"