Difference between revisions of "TYROSINE--TRNA-LIGASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15654 CPD-15654] == * smiles: ** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Gene == Gene Ec-15_004850 == * Synonym(s): ** Esi_0156_0032 ** Esi0156_0032 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15654 CPD-15654] ==
+
== Gene Ec-15_004850 ==
−
* smiles:
+
−
** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=SZKPLUULGGERFD-NFPSBOAPSA-J
+
−
* common name:
+
−
** 2-trans, 4-cis-undecadienoyl-CoA
+
−
* molecular weight:
+
−
** 927.749   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2E, 4Z-undecadienoyl-CoA
+
** Esi_0156_0032
 +
** Esi0156_0032
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14776]]
+
* Reaction: [[RXN-8443]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
−
* [[RXN-14775]]
+
== Pathways associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=Esi_0156_0032|Esi0156_0032}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658228 90658228]
+
{{#set: reaction associated=RXN-8443}}
−
{{#set: smiles=CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: pathway associated=PWY-5381}}
−
{{#set: inchi key=InChIKey=SZKPLUULGGERFD-NFPSBOAPSA-J}}
+
−
{{#set: common name=2-trans, 4-cis-undecadienoyl-CoA}}
+
−
{{#set: molecular weight=927.749    }}
+
−
{{#set: common name=2E, 4Z-undecadienoyl-CoA}}
+
−
{{#set: consumed by=RXN-14776}}
+
−
{{#set: produced by=RXN-14775}}
+

Revision as of 13:45, 21 March 2018

Gene Ec-15_004850

  • Synonym(s):
    • Esi_0156_0032
    • Esi0156_0032

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=TYROSINE--TRNA-LIGASE-RXN&oldid=21379"