Difference between revisions of "RIBOFLAVINSYNDEAM-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP...")
(Created page with "Category:Gene == Gene Ec-01_001800 == * Synonym(s): ** Esi_0112_0060 ** Esi0112_0060 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] ==
+
== Gene Ec-01_001800 ==
−
* smiles:
+
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J
+
−
* common name:
+
−
** benzoyl-CoA
+
−
* molecular weight:
+
−
** 867.61   
+
 
* Synonym(s):
 
* Synonym(s):
−
** S-benzoate coenzyme A
+
** Esi_0112_0060
−
** benzoyl-S-CoA
+
** Esi0112_0060
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-8443]]
−
* [[RXN-2006]]
+
** Source: [[orthology-aragem]]
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
−
* CAS : 102185-37-5
+
{{#set: common name=Esi_0112_0060|Esi0112_0060}}
−
* PUBCHEM:
+
{{#set: reaction associated=RXN-8443}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266596 45266596]
+
{{#set: pathway associated=PWY-5381}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57369 57369]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00512 C00512]
+
−
* HMDB : HMDB02252
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J}}
+
−
{{#set: common name=benzoyl-CoA}}
+
−
{{#set: molecular weight=867.61    }}
+
−
{{#set: common name=S-benzoate coenzyme A|benzoyl-S-CoA}}
+
−
{{#set: produced by=RXN-2006}}
+

Revision as of 13:46, 21 March 2018

Gene Ec-01_001800

  • Synonym(s):
    • Esi_0112_0060
    • Esi0112_0060

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RIBOFLAVINSYNDEAM-RXN&oldid=21430"