Difference between revisions of "GLUTSEMIALDEHYDROG-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-592 CPD-592] == * smiles: ** C([O-])(=O)CCCNC(=[N+])N * inchi key: ** InChIKey=TUHVEAJXIMEO...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15006 RXN-15006] == * direction: ** LEFT-TO-RIGHT * common name: ** N-acetyl-gamma-glutamyl-pho...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-592 CPD-592] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15006 RXN-15006] ==
* smiles:
+
* direction:
** C([O-])(=O)CCCNC(=[N+])N
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=TUHVEAJXIMEOSA-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 4-guanidinobutanoate
+
** N-acetyl-gamma-glutamyl-phosphate reductase, C-terminal part
* molecular weight:
+
* ec number:
** 145.161   
+
** [http://enzyme.expasy.org/EC/1.2.1.38 EC-1.2.1.38]
 
* Synonym(s):
 
* Synonym(s):
** 4-guanido-butyrate
 
** γ-guanidinobutyrate
 
** 4-guanidinobutyrate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[GUANIDINOBUTYRASE-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[LysW-L-glutamate-5-phosphate]][c] '''=>''' 1 [[LysW-L-glutamate-5-semialdehyde]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[Pi]][c]
* [[GUANIDINOBUTANAMIDE-NH3-RXN]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 an [L-2-aminoadipate carrier protein]-L-glutamate 5-phosphate[c] '''=>''' 1 an [L-2-aminoadipate carrier protein]-L-glutamate 5-semialdehyde[c] '''+''' 1 NADP+[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-21_003520]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7400]], L-arginine biosynthesis IV (archaebacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7400 PWY-7400]
 +
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?C01035 C01035]
+
{{#set: common name=N-acetyl-gamma-glutamyl-phosphate reductase, C-terminal part}}
* CHEBI:
+
{{#set: ec number=EC-1.2.1.38}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57486 57486]
+
{{#set: gene associated=Ec-21_003520}}
* METABOLIGHTS : MTBLC57486
+
{{#set: in pathway=PWY-7400}}
* PUBCHEM:
+
{{#set: reconstruction category=annotation}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200642 25200642]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
* HMDB : HMDB03464
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: smiles=C([O-])(=O)CCCNC(=[N+])N}}
+
{{#set: inchi key=InChIKey=TUHVEAJXIMEOSA-UHFFFAOYSA-N}}
+
{{#set: common name=4-guanidinobutanoate}}
+
{{#set: molecular weight=145.161    }}
+
{{#set: common name=4-guanido-butyrate|γ-guanidinobutyrate|4-guanidinobutyrate}}
+
{{#set: consumed by=GUANIDINOBUTYRASE-RXN}}
+
{{#set: produced by=GUANIDINOBUTANAMIDE-NH3-RXN}}
+

Revision as of 13:46, 21 March 2018

Reaction RXN-15006

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • N-acetyl-gamma-glutamyl-phosphate reductase, C-terminal part
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7400, L-arginine biosynthesis IV (archaebacteria): PWY-7400
    • 7 reactions found over 9 reactions in the full pathway

Reconstruction information

External links