Difference between revisions of "TRNA-Containing-5MeAminoMe-2-ThioU"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14382 RXN-14382] == * direction: ** LEFT-TO-RIGHT * common name: ** Aminotransferase class V do...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14382 RXN-14382] ==
−
* smiles:
+
* direction:
−
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
+
 
* common name:
 
* common name:
−
** isofucosterol
+
** Aminotransferase class V domain
−
* molecular weight:
+
** Cysteine desulfurase
−
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-4210]]
+
** 1 [[Sulfur-Carrier-Proteins-ThiI]][c] '''+''' 1 [[L-Cysteine-Desulfurase-persulfide]][c] '''=>''' 1 [[Cysteine-Desulfurase-L-cysteine]][c] '''+''' 1 [[Sulfurylated-ThiI]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a ThiI sulfur-carrier protein[c] '''+''' 1 an [L-cysteine desulfurase] L-cysteine persulfide[c] '''=>''' 1 an [L-cysteine desulfurase]-L-cysteine[c] '''+''' 1 an S-sulfanyl-[ThiI sulfur-carrier protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-21_005640]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-22_000950]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-21_003740]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6892]], thiazole biosynthesis I (facultative anaerobic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6892 PWY-6892]
 +
** '''3''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244964 25244964]
+
{{#set: common name=Aminotransferase class V domain}}
−
* LIGAND-CPD:
+
{{#set: common name=Cysteine desulfurase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08821 C08821]
+
{{#set: gene associated=Ec-21_005640|Ec-22_000950|Ec-21_003740}}
−
* HMDB : HMDB02374
+
{{#set: in pathway=PWY-6892}}
−
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=isofucosterol}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=412.698    }}
+
−
{{#set: produced by=RXN-4210}}
+

Revision as of 13:46, 21 March 2018

Reaction RXN-14382

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Aminotransferase class V domain
    • Cysteine desulfurase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6892, thiazole biosynthesis I (facultative anaerobic bacteria): PWY-6892
    • 3 reactions found over 7 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=TRNA-Containing-5MeAminoMe-2-ThioU&oldid=21484"