Difference between revisions of "MALTOHEXAOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1P RIBOSE-1P] == * smiles: ** C(O)C1(C(O)C(O)C(OP(=O)([O-])[O-])O1) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Ec-27_005030 == * left end position: ** 4554906 * transcription direction: ** NEGATIVE * right end position: ** 4563758 * centisome position: ** 70.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-27_005030 == |
− | * | + | * left end position: |
− | ** | + | ** 4554906 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4563758 |
− | * | + | * centisome position: |
− | ** | + | ** 70.61971 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0000_0270 |
− | ** | + | ** Esi0000_0270 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[GLUCOKIN-RXN]] | |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: go-term |
+ | * Reaction: [[HEXOKINASE-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[TREDEGLOW-PWY]] | ||
+ | * [[GLYCOCAT-PWY]] | ||
+ | * [[PWY-621]] | ||
+ | * [[PWY-7385]] | ||
+ | * [[GLUCOSE1PMETAB-PWY]] | ||
+ | * [[PWY0-1182]] | ||
+ | * [[P124-PWY]] | ||
+ | * [[PWY-5514]] | ||
+ | * [[PWY-2722]] | ||
+ | * [[PWY-7238]] | ||
+ | * [[ANAGLYCOLYSIS-PWY]] | ||
+ | * [[PWY-2723]] | ||
+ | * [[P122-PWY]] | ||
+ | * [[PWY-5661]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4554906}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4563758}} | |
− | + | {{#set: centisome position=70.61971 }} | |
− | + | {{#set: common name=Esi_0000_0270|Esi0000_0270}} | |
− | + | {{#set: reaction associated=GLUCOKIN-RXN|HEXOKINASE-RXN}} | |
− | + | {{#set: pathway associated=TREDEGLOW-PWY|GLYCOCAT-PWY|PWY-621|PWY-7385|GLUCOSE1PMETAB-PWY|PWY0-1182|P124-PWY|PWY-5514|PWY-2722|PWY-7238|ANAGLYCOLYSIS-PWY|PWY-2723|P122-PWY|PWY-5661}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 13:46, 21 March 2018
Gene Ec-27_005030
- left end position:
- 4554906
- transcription direction:
- NEGATIVE
- right end position:
- 4563758
- centisome position:
- 70.61971
- Synonym(s):
- Esi_0000_0270
- Esi0000_0270
Reactions associated
- Reaction: GLUCOKIN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: HEXOKINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
Pathways associated
- TREDEGLOW-PWY
- GLYCOCAT-PWY
- PWY-621
- PWY-7385
- GLUCOSE1PMETAB-PWY
- PWY0-1182
- P124-PWY
- PWY-5514
- PWY-2722
- PWY-7238
- ANAGLYCOLYSIS-PWY
- PWY-2723
- P122-PWY
- PWY-5661