Difference between revisions of "IMIDAZOLE-ACETOL-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE-P CREATINE-P] == * smiles: ** C(C(=O)[O-])N(C)C(NP(=O)([O-])[O-])=[N+] * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.5.1.27-RXN 3.5.1.27-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** peptide deformylase *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.5.1.27-RXN 3.5.1.27-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** peptide deformylase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.5.1.88 EC-3.5.1.88] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[WATER]][c] '''+''' 1 [[Charged-fMET-tRNAs]][c] '''=>''' 1 [[FORMATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[L-Methionylaminoacyl-tRNAs]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 H2O[c] '''+''' 1 an N-formyl-L-methionylaminoacyl-tRNA[c] '''=>''' 1 formate[c] '''+''' 1 H+[c] '''+''' 1 a L-methionylaminoacyl-tRNA[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-24_001990]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-24_001980]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04268 R04268] | |
− | + | * UNIPROT: | |
− | + | ** [http://www.uniprot.org/uniprot/P44786 P44786] | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/P0A6K3 P0A6K3] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | * | + | {{#set: common name=peptide deformylase}} |
− | ** [http://www. | + | {{#set: ec number=EC-3.5.1.88}} |
− | + | {{#set: gene associated=Ec-24_001990|Ec-24_001980}} | |
− | ** [http://www. | + | {{#set: in pathway=}} |
− | + | {{#set: reconstruction category=annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:46, 21 March 2018
Contents
Reaction 3.5.1.27-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- peptide deformylase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 Charged-fMET-tRNAs[c] => 1 FORMATE[c] + 1 PROTON[c] + 1 L-Methionylaminoacyl-tRNAs[c]
- With common name(s):
- 1 H2O[c] + 1 an N-formyl-L-methionylaminoacyl-tRNA[c] => 1 formate[c] + 1 H+[c] + 1 a L-methionylaminoacyl-tRNA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-24_001990
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-24_001980
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links