Difference between revisions of "Ec-27 004020"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP UDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALANINE-AMINOTRANSFERASE-RXN ALANINE-AMINOTRANSFERASE-RXN] == * direction: ** REVERSIBLE * common n...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALANINE-AMINOTRANSFERASE-RXN ALANINE-AMINOTRANSFERASE-RXN] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** Glutamate:glyoxylate aminotransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.6.1.2 EC-2.6.1.2] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[L-ALPHA-ALANINE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''<=>''' 1 [[PYRUVATE]][c] '''+''' 1 [[GLT]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 L-alanine[c] '''+''' 1 2-oxoglutarate[c] '''<=>''' 1 pyruvate[c] '''+''' 1 L-glutamate[c] | |
− | + | ||
− | * [ | + | == Genes associated with this reaction == |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | * [[ | + | * [[Ec-01_011040]] |
− | * | + | ** ESILICULOSUS_GENOME |
− | * [[ | + | ***EC-NUMBER |
− | + | ** [[pantograph]]-[[aragem]] | |
− | * [[ | + | ** [[pantograph]]-[[aragem]] |
− | + | == Pathways == | |
− | * [[ | + | * [[ALANINE-DEG3-PWY]], L-alanine degradation III: [http://metacyc.org/META/NEW-IMAGE?object=ALANINE-DEG3-PWY ALANINE-DEG3-PWY] |
− | + | ** '''1''' reactions found over '''1''' reactions in the full pathway | |
− | * | + | * [[PWY-7383]], anaerobic energy metabolism (invertebrates, cytosol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7383 PWY-7383] |
− | * [[ | + | ** '''4''' reactions found over '''7''' reactions in the full pathway |
− | + | * [[PWY-7117]], C4 photosynthetic carbon assimilation cycle, PEPCK type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7117 PWY-7117] | |
− | * | + | ** '''9''' reactions found over '''10''' reactions in the full pathway |
− | * [[ | + | * [[ALACAT2-PWY]], L-alanine degradation II (to D-lactate): [http://metacyc.org/META/NEW-IMAGE?object=ALACAT2-PWY ALACAT2-PWY] |
− | + | ** '''2''' reactions found over '''3''' reactions in the full pathway | |
− | * | + | * [[PWY-7115]], C4 photosynthetic carbon assimilation cycle, NAD-ME type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7115 PWY-7115] |
− | * [[ | + | ** '''9''' reactions found over '''9''' reactions in the full pathway |
− | + | * [[ALANINE-SYN2-PWY]], L-alanine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=ALANINE-SYN2-PWY ALANINE-SYN2-PWY] | |
− | + | ** '''1''' reactions found over '''1''' reactions in the full pathway | |
− | * | + | == Reconstruction information == |
− | * [[ | + | * Category: [[orthology]] |
− | + | ** Source: [[orthology-aragem]] | |
− | * | + | *** Tool: [[pantograph]] |
− | * [[ | + | * Category: [[annotation]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Tool: [[pathwaytools]] | |
− | * | + | |
− | == | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19453 19453] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00258 R00258] |
− | + | * UNIPROT: | |
− | + | ** [http://www.uniprot.org/uniprot/P13191 P13191] | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/P25409 P25409] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P24298 P24298] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9UR81 Q9UR81] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P34106 P34106] |
− | * | + | ** [http://www.uniprot.org/uniprot/P52894 P52894] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q42685 Q42685] |
− | * | + | {{#set: direction=REVERSIBLE}} |
− | + | {{#set: common name=Glutamate:glyoxylate aminotransferase}} | |
− | {{#set: | + | {{#set: ec number=EC-2.6.1.2}} |
− | {{#set: common name= | + | {{#set: gene associated=Ec-01_011040}} |
− | {{#set: | + | {{#set: in pathway=ALANINE-DEG3-PWY|PWY-7383|PWY-7117|ALACAT2-PWY|PWY-7115|ALANINE-SYN2-PWY}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + |
Revision as of 21:42, 17 March 2018
Contents
Reaction ALANINE-AMINOTRANSFERASE-RXN
- direction:
- REVERSIBLE
- common name:
- Glutamate:glyoxylate aminotransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 L-ALPHA-ALANINE[c] + 1 2-KETOGLUTARATE[c] <=> 1 PYRUVATE[c] + 1 GLT[c]
- With common name(s):
- 1 L-alanine[c] + 1 2-oxoglutarate[c] <=> 1 pyruvate[c] + 1 L-glutamate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Ec-01_011040
- ESILICULOSUS_GENOME
- EC-NUMBER
- pantograph-aragem
- pantograph-aragem
- ESILICULOSUS_GENOME
Pathways
- ALANINE-DEG3-PWY, L-alanine degradation III: ALANINE-DEG3-PWY
- 1 reactions found over 1 reactions in the full pathway
- PWY-7383, anaerobic energy metabolism (invertebrates, cytosol): PWY-7383
- 4 reactions found over 7 reactions in the full pathway
- PWY-7117, C4 photosynthetic carbon assimilation cycle, PEPCK type: PWY-7117
- 9 reactions found over 10 reactions in the full pathway
- ALACAT2-PWY, L-alanine degradation II (to D-lactate): ALACAT2-PWY
- 2 reactions found over 3 reactions in the full pathway
- PWY-7115, C4 photosynthetic carbon assimilation cycle, NAD-ME type: PWY-7115
- 9 reactions found over 9 reactions in the full pathway
- ALANINE-SYN2-PWY, L-alanine biosynthesis II: ALANINE-SYN2-PWY
- 1 reactions found over 1 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links