Difference between revisions of "2E-9Z-octadeca-2-9-dienoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-00_001300 == * left end position: ** 1548233 * transcription direction: ** POSITIVE * right end position: ** 1559191 * centisome position: ** 8.17...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-00_001300 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] ==
−
* left end position:
+
* smiles:
−
** 1548233
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N
−
* right end position:
+
* common name:
−
** 1559191
+
** 6-oxocampestanol
−
* centisome position:
+
* molecular weight:
−
** 8.171634    
+
** 416.686    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0013_0077
+
** oxocampestanol
−
** Esi0013_0077
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[DOLICHOL-KINASE-RXN]]
+
* [[RXN-715]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PWY-6129]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=1548233}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200917 25200917]
−
{{#set: right end position=1559191}}
+
* LIGAND-CPD:
−
{{#set: centisome position=8.171634   }}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15789 C15789]
−
{{#set: common name=Esi_0013_0077|Esi0013_0077}}
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: reaction associated=DOLICHOL-KINASE-RXN}}
+
{{#set: inchi key=InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N}}
−
{{#set: pathway associated=PWY-6129}}
+
{{#set: common name=6-oxocampestanol}}
 +
{{#set: molecular weight=416.686   }}
 +
{{#set: common name=oxocampestanol}}
 +
{{#set: consumed by=RXN-715}}

Revision as of 13:46, 21 March 2018

Metabolite CPD-713

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N
  • common name:
    • 6-oxocampestanol
  • molecular weight:
    • 416.686
  • Synonym(s):
    • oxocampestanol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=2E-9Z-octadeca-2-9-dienoyl-ACPs&oldid=21543"