Difference between revisions of "BIOMASS"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-13_002660 == * left end position: ** 4360910 * transcription direction: ** POSITIVE * right end position: ** 4362118 * centisome position: ** 62.8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] == * smiles: ** CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ZMTPZDVBGYNPLZ-YGOWEZGDSA-M |
| − | * | + | * common name: |
| − | ** | + | ** epoxypheophorbide a |
| − | * | + | * molecular weight: |
| − | ** | + | ** 606.677 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-17253]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-17252]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7))))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ZMTPZDVBGYNPLZ-YGOWEZGDSA-M}} |
| − | {{#set: | + | {{#set: common name=epoxypheophorbide a}} |
| − | {{#set: | + | {{#set: molecular weight=606.677 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-17253}} |
| − | + | {{#set: produced by=RXN-17252}} | |
| − | {{#set: | + | |
Revision as of 13:47, 21 March 2018
Contents
Metabolite CPD-18666
- smiles:
- CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7))))
- inchi key:
- InChIKey=ZMTPZDVBGYNPLZ-YGOWEZGDSA-M
- common name:
- epoxypheophorbide a
- molecular weight:
- 606.677
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7))))" cannot be used as a page name in this wiki.
