Difference between revisions of "Ec-09 002410"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] == * smiles: ** CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6550 RXN-6550] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6550 RXN-6550] ==
−
* smiles:
+
* direction:
−
** CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=ZMTPZDVBGYNPLZ-YGOWEZGDSA-M
+
** [http://enzyme.expasy.org/EC/1.14.11 EC-1.14.11]
−
* common name:
+
−
** epoxypheophorbide a
+
−
* molecular weight:
+
−
** 606.677   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17253]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[CPD1F-137]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[SUC]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-6224]][c]
−
* [[RXN-17252]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 2-oxoglutarate[c] '''+''' 1 gibberellin A4[c] '''+''' 1 oxygen[c] '''=>''' 1 succinate[c] '''+''' 1 CO2[c] '''+''' 1 gibberellin A34[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-19_002750]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-08_003510]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-19_002760]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-102]], gibberellin inactivation I (2β-hydroxylation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-102 PWY-102]
 +
** '''4''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7))))}}
+
* LIGAND-RXN:
−
{{#set: inchi key=InChIKey=ZMTPZDVBGYNPLZ-YGOWEZGDSA-M}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R06338 R06338]
−
{{#set: common name=epoxypheophorbide a}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: molecular weight=606.677    }}
+
{{#set: ec number=EC-1.14.11}}
−
{{#set: consumed by=RXN-17253}}
+
{{#set: gene associated=Ec-19_002750|Ec-08_003510|Ec-19_002760}}
−
{{#set: produced by=RXN-17252}}
+
{{#set: in pathway=PWY-102}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-aragem}}
 +
{{#set: reconstruction tool=pantograph}}

Revision as of 14:47, 21 March 2018

Reaction RXN-6550

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-102, gibberellin inactivation I (2β-hydroxylation): PWY-102
    • 4 reactions found over 11 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-09_002410&oldid=21652"