Difference between revisions of "L-BETA-ASPARTYL-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHYDROCHLORIN SIROHYDROCHLORIN] == * smiles: ** CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-281 RXN66-281] == * direction: ** LEFT-TO-RIGHT * common name: ** squalene synthase ** Isopen...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHYDROCHLORIN SIROHYDROCHLORIN] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-281 RXN66-281] ==
−
* smiles:
+
* direction:
−
** CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C(C=C(N1)C(CCC(=O)[O-])2)C(CC(=O)[O-])=C(CCC(=O)[O-])3))=C(CCC(=O)[O-])C(CC(=O)[O-])=4))C(C)(CC(=O)[O-])C(CCC(=O)[O-])5)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=KWIZRXMMFRBUML-AHGFGAHVSA-F
+
 
* common name:
 
* common name:
−
** sirohydrochlorin
+
** squalene synthase
−
* molecular weight:
+
** Isopentenyl-diphosphate delta-isomerase type 1 fused to squalene synthase; probably two separate ORFs
−
** 854.779   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Precorrin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[4.99.1.3-RXN]]
+
* With identifiers:
−
* [[SIROHEME-FERROCHELAT-RXN]]
+
** 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[CPD-465]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[SQUALENE]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[PPI]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 NAD(P)H[c] '''+''' 1 presqualene diphosphate[c] '''+''' 1 H+[c] '''=>''' 1 squalene[c] '''+''' 1 NAD(P)+[c] '''+''' 1 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-11_001030]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 65207-12-7
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R02872 R02872]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245154 25245154]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* CHEBI:
+
{{#set: common name=squalene synthase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58351 58351]
+
{{#set: common name=Isopentenyl-diphosphate delta-isomerase type 1 fused to squalene synthase; probably two separate ORFs}}
−
* BIGG : 46482
+
{{#set: gene associated=Ec-11_001030}}
−
* LIGAND-CPD:
+
{{#set: in pathway=}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05778 C05778]
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C(C=C(N1)C(CCC(=O)[O-])2)C(CC(=O)[O-])=C(CCC(=O)[O-])3))=C(CCC(=O)[O-])C(CC(=O)[O-])=4))C(C)(CC(=O)[O-])C(CCC(=O)[O-])5)))}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: inchi key=InChIKey=KWIZRXMMFRBUML-AHGFGAHVSA-F}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=sirohydrochlorin}}
+
−
{{#set: molecular weight=854.779    }}
+
−
{{#set: common name=Precorrin}}
+
−
{{#set: consumed by=4.99.1.3-RXN|SIROHEME-FERROCHELAT-RXN}}
+

Revision as of 14:48, 21 March 2018

Reaction RXN66-281

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • squalene synthase
    • Isopentenyl-diphosphate delta-isomerase type 1 fused to squalene synthase; probably two separate ORFs
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=L-BETA-ASPARTYL-P&oldid=21807"