Difference between revisions of "RXN0-6491"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEOYL-COA OLEOYL-COA] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] == * smiles: ** C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1) * inchi key: *...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** N-formyl-D-kynurenine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 236.227 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8664]] |
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245041 25245041] |
| − | * HMDB : | + | * CHEBI: |
| − | {{#set: smiles= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=55476 55476] |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15605 C15605] |
| − | {{#set: molecular weight= | + | * HMDB : HMDB01200 |
| − | + | {{#set: smiles=C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)}} | |
| − | + | {{#set: inchi key=InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N}} | |
| − | {{#set: produced by=RXN- | + | {{#set: common name=N-formyl-D-kynurenine}} |
| − | + | {{#set: molecular weight=236.227 }} | |
| + | {{#set: produced by=RXN-8664}} | ||
Revision as of 14:48, 21 March 2018
Contents
Metabolite CPD-10488
- smiles:
- C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)
- inchi key:
- InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N
- common name:
- N-formyl-D-kynurenine
- molecular weight:
- 236.227
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)" cannot be used as a page name in this wiki.
