Difference between revisions of "L-methionyl-tRNAfmet"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-20_001490 == * left end position: ** 1508080 * transcription direction: ** NEGATIVE * right end position: ** 1515516 * centisome position: ** 29.2...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == * smiles: ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O * inchi...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-20_001490 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] ==
−
* left end position:
+
* smiles:
−
** 1508080
+
** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M
−
* right end position:
+
* common name:
−
** 1515516
+
** D-nopaline
−
* centisome position:
+
* molecular weight:
−
** 29.246643    
+
** 303.294    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0023_0024
+
** N2-(D-1,3-dicarboxypropyl)-L-arginine
−
** Esi0023_0024
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-14570]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[1.5.1.19-RXN]]
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PWY0-1587]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=1508080}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791983 49791983]
−
{{#set: right end position=1515516}}
+
* CHEBI:
−
{{#set: centisome position=29.246643   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58074 58074]
−
{{#set: common name=Esi_0023_0024|Esi0023_0024}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=RXN-14570}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01682 C01682]
−
{{#set: pathway associated=PWY0-1587}}
+
{{#set: smiles=C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O}}
 +
{{#set: inchi key=InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M}}
 +
{{#set: common name=D-nopaline}}
 +
{{#set: molecular weight=303.294   }}
 +
{{#set: common name=N2-(D-1,3-dicarboxypropyl)-L-arginine}}
 +
{{#set: produced by=1.5.1.19-RXN}}

Revision as of 13:48, 21 March 2018

Metabolite CPD-308

  • smiles:
    • C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O
  • inchi key:
    • InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M
  • common name:
    • D-nopaline
  • molecular weight:
    • 303.294
  • Synonym(s):
    • N2-(D-1,3-dicarboxypropyl)-L-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=L-methionyl-tRNAfmet&oldid=21825"