Difference between revisions of "RXN-15816"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=RGH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-409 CPD-409] == * common name: ** a 2-monoglyceride * Synonym(s): ** a 2-acylglycerol ** a...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-409 CPD-409] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a 2-monoglyceride |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a 2-acylglycerol |
| − | ** | + | ** a 2-glyceride |
| − | ** | + | ** a 2-MAG |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-1603]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-1602]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-12383]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a 2-monoglyceride}} | |
| − | + | {{#set: common name=a 2-acylglycerol|a 2-glyceride|a 2-MAG}} | |
| − | + | {{#set: consumed by=RXN-1603}} | |
| − | + | {{#set: produced by=RXN-1602}} | |
| − | + | {{#set: reversible reaction associated=RXN-12383}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Revision as of 13:49, 21 March 2018
Contents
Metabolite CPD-409
- common name:
- a 2-monoglyceride
- Synonym(s):
- a 2-acylglycerol
- a 2-glyceride
- a 2-MAG
