Difference between revisions of "FORMATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDP-MANNOSE-6-DEHYDROGENASE-RXN GDP-MANNOSE-6-DEHYDROGENASE-RXN] == * direction: ** LEFT-TO-RIGHT *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-695 CPD-695] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-695 CPD-695] == |
− | * | + | * smiles: |
− | ** | + | ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O))) |
+ | * inchi key: | ||
+ | ** InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** gibberellin A53 |
− | * | + | * molecular weight: |
− | ** | + | ** 346.422 |
* Synonym(s): | * Synonym(s): | ||
+ | ** GA53 | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN1F-167]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203620 25203620] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27433 27433] |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06094 C06094] |
− | + | * HMDB : HMDB36895 | |
− | {{#set: | + | {{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}} |
− | + | {{#set: inchi key=InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L}} | |
− | {{#set: | + | {{#set: common name=gibberellin A53}} |
− | {{#set: | + | {{#set: molecular weight=346.422 }} |
− | {{#set: | + | {{#set: common name=GA53}} |
− | {{#set: | + | {{#set: consumed by=RXN1F-167}} |
− | {{#set: | + |
Revision as of 13:49, 21 March 2018
Contents
Metabolite CPD-695
- smiles:
- C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
- inchi key:
- InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L
- common name:
- gibberellin A53
- molecular weight:
- 346.422
- Synonym(s):
- GA53
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.