Difference between revisions of "RXN-12625"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * smiles: ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) * inchi key: ** InChIKey=...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12445 RXN-12445] == * direction: ** LEFT-TO-RIGHT * common name: ** riboflavin reductase (NADPH...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12445 RXN-12445] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** riboflavin reductase (NADPH) |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.5.1.41 EC-1.5.1.41] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 2 [[PROTON]][c] '''+''' 1 [[RIBOFLAVIN]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''=>''' 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[CPD-316]][c] |
| − | == | + | * With common name(s): |
| + | ** 2 H+[c] '''+''' 1 riboflavin[c] '''+''' 1 NAD(P)H[c] '''=>''' 1 NAD(P)+[c] '''+''' 1 reduced riboflavin[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-27_006530]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: GO-TERM | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31458 31458] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=riboflavin reductase (NADPH)}} | |
| − | + | {{#set: ec number=EC-1.5.1.41}} | |
| − | ** [http://www.ebi.ac.uk/ | + | {{#set: gene associated=Ec-27_006530}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 13:49, 21 March 2018
Contents
Reaction RXN-12445
- direction:
- LEFT-TO-RIGHT
- common name:
- riboflavin reductase (NADPH)
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 PROTON[c] + 1 RIBOFLAVIN[c] + 1 NADH-P-OR-NOP[c] => 1 NAD-P-OR-NOP[c] + 1 CPD-316[c]
- With common name(s):
- 2 H+[c] + 1 riboflavin[c] + 1 NAD(P)H[c] => 1 NAD(P)+[c] + 1 reduced riboflavin[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-27_006530
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
