Difference between revisions of "Ec-17 002880"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] == * smiles: ** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7666 RXN-7666] == * direction: ** LEFT-TO-RIGHT * common name: ** Geranylgeranyl reductase * Sy...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7666 RXN-7666] ==
−
* smiles:
+
* direction:
−
** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N
+
 
* common name:
 
* common name:
−
** 3'-ketolactose
+
** Geranylgeranyl reductase
−
* molecular weight:
+
−
** 340.283   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[KETOLACTOSE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[CPD-7006]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[CHLOROPHYLL-A]][c] '''+''' 1 [[NADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H+[c] '''+''' 1 tetrahydrogeranylgeranyl chlorophyll a[c] '''+''' 1 NADPH[c] '''=>''' 1 chlorophyll a[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-03_003520]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-5064]], chlorophyll a biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5064 PWY-5064]
 +
** '''3''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27571 27571]
+
{{#set: common name=Geranylgeranyl reductase}}
−
* KEGG-GLYCAN : G10531
+
{{#set: gene associated=Ec-03_003520}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-5064}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05403 C05403]
+
{{#set: reconstruction category=annotation}}
−
* PUBCHEM:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201057 25201057]
+
{{#set: reconstruction tool=pathwaytools}}
−
* HMDB : HMDB01030
+
−
{{#set: smiles=C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)}}
+
−
{{#set: inchi key=InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N}}
+
−
{{#set: common name=3'-ketolactose}}
+
−
{{#set: molecular weight=340.283    }}
+
−
{{#set: common name=3'-dehydro-β-D-galactosyl-β-D-glucopyranoside}}
+
−
{{#set: consumed by=KETOLACTOSE-RXN}}
+

Revision as of 13:49, 21 March 2018

Reaction RXN-7666

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Geranylgeranyl reductase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H+[c] + 1 tetrahydrogeranylgeranyl chlorophyll a[c] + 1 NADPH[c] => 1 chlorophyll a[c] + 1 NADP+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5064, chlorophyll a biosynthesis II: PWY-5064
    • 3 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-17_002880&oldid=21974"