Difference between revisions of "7Z-3-oxo-hexadec-7-enoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] == * smiles: ** C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12)) * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Ec-07_006150 == * left end position: ** 5981248 * transcription direction: ** POSITIVE * right end position: ** 5984988 * centisome position: ** 77.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-07_006150 == |
− | * | + | * left end position: |
− | ** | + | ** 5981248 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5984988 |
− | * | + | * centisome position: |
− | ** | + | ** 77.45293 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0148_0072 |
− | ** | + | ** Esi0148_0072 |
− | ** | + | ** FKB11 |
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * | + | *** Assignment: ec-number |
− | * [[ | + | == Pathways associated == |
− | * | + | |
− | * | + | |
− | + | ||
− | * | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5981248}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5984988}} | |
− | + | {{#set: centisome position=77.45293 }} | |
− | + | {{#set: common name=Esi_0148_0072|Esi0148_0072|FKB11}} | |
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 13:50, 21 March 2018
Gene Ec-07_006150
- left end position:
- 5981248
- transcription direction:
- POSITIVE
- right end position:
- 5984988
- centisome position:
- 77.45293
- Synonym(s):
- Esi_0148_0072
- Esi0148_0072
- FKB11
Reactions associated
- Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome