Difference between revisions of "RIBULP3EPIM-RXN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDOSE-1-EPIMERASE-RXN ALDOSE-1-EPIMERASE-RXN] == * direction: ** REVERSIBLE * ec number: ** [http:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] == * smiles: ** C(=O)([O-])CC(O)C([O-])=O * inchi key: ** InChIKey=BJEPYKJPYRNKOW-REOH...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])CC(O)C([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=BJEPYKJPYRNKOW-REOHCLBHSA-L |
+ | * common name: | ||
+ | ** (S)-malate | ||
+ | * molecular weight: | ||
+ | ** 132.073 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (S)-malic acid | ||
+ | ** L-apple acid | ||
+ | ** L-malic acid | ||
+ | ** L-hydroxysuccinic acid | ||
+ | ** L-hydroxybutanedioic acid | ||
+ | ** L-malate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[1.1.1.39-RXN]] |
− | + | * [[MALIC-NADP-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[MALSYN-RXN]] | |
− | + | * [[RXN-6002]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | * [[MALATE-DEH-RXN]] | |
− | * [[ | + | * [[FUMHYDR-RXN]] |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | + | ||
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 6915-15-7 |
− | ** [http:// | + | * CAS : 97-67-6 |
− | * LIGAND- | + | * BIGG : 34045 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * PUBCHEM: |
− | * | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459792 5459792] |
− | ** [http://www. | + | * HMDB : HMDB00156 |
− | + | * LIGAND-CPD: | |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00149 C00149] |
− | ** [http://www. | + | * CHEMSPIDER: |
− | + | ** [http://www.chemspider.com/Chemical-Structure.4573566.html 4573566] | |
− | + | * CHEBI: | |
− | * | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15589 15589] |
− | + | * METABOLIGHTS : MTBLC15589 | |
− | + | {{#set: smiles=C(=O)([O-])CC(O)C([O-])=O}} | |
− | + | {{#set: inchi key=InChIKey=BJEPYKJPYRNKOW-REOHCLBHSA-L}} | |
− | + | {{#set: common name=(S)-malate}} | |
− | {{#set: | + | {{#set: molecular weight=132.073 }} |
− | {{#set: | + | {{#set: common name=(S)-malic acid|L-apple acid|L-malic acid|L-hydroxysuccinic acid|L-hydroxybutanedioic acid|L-malate}} |
− | {{#set: | + | {{#set: consumed by=1.1.1.39-RXN|MALIC-NADP-RXN}} |
− | {{#set: | + | {{#set: produced by=MALSYN-RXN|RXN-6002}} |
− | {{#set: | + | {{#set: reversible reaction associated=MALATE-DEH-RXN|FUMHYDR-RXN}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:50, 21 March 2018
Contents
Metabolite MAL
- smiles:
- C(=O)([O-])CC(O)C([O-])=O
- inchi key:
- InChIKey=BJEPYKJPYRNKOW-REOHCLBHSA-L
- common name:
- (S)-malate
- molecular weight:
- 132.073
- Synonym(s):
- (S)-malic acid
- L-apple acid
- L-malic acid
- L-hydroxysuccinic acid
- L-hydroxybutanedioic acid
- L-malate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 6915-15-7
- CAS : 97-67-6
- BIGG : 34045
- PUBCHEM:
- HMDB : HMDB00156
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC15589
"C(=O)([O-])CC(O)C([O-])=O" cannot be used as a page name in this wiki.