Difference between revisions of "PWY-5168"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] == * smiles: ** CC(=CCCC(=CCOP([O-])(OP(=O)([O-])[O-])=O)C)C * inchi key...") |
(Created page with "Category:Gene == Gene Ec-10_001310 == * left end position: ** 1400047 * transcription direction: ** NEGATIVE * right end position: ** 1402580 * centisome position: ** 21.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-10_001310 == |
− | * | + | * left end position: |
− | ** | + | ** 1400047 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1402580 |
− | * | + | * centisome position: |
− | ** | + | ** 21.535921 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0073_0088 |
− | ** | + | ** Esi0073_0088 |
− | ** | + | ** MAPK |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PROTEIN-KINASE-RXN]] |
− | * | + | ** esiliculosus_genome |
− | == | + | ***go-term |
− | + | == Pathways associated == | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1400047}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1402580}} | |
− | + | {{#set: centisome position=21.535921 }} | |
− | + | {{#set: common name=Esi_0073_0088|Esi0073_0088|MAPK}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 20:43, 17 March 2018
Gene Ec-10_001310
- left end position:
- 1400047
- transcription direction:
- NEGATIVE
- right end position:
- 1402580
- centisome position:
- 21.535921
- Synonym(s):
- Esi_0073_0088
- Esi0073_0088
- MAPK
Reactions associated
- PROTEIN-KINASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome