Difference between revisions of "2.3.1.97-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5260 RXN0-5260] == * direction: ** LEFT-TO-RIGHT * common name: ** sn-glycerol 3-phosphate:ubi...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5260 RXN0-5260] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N
 
* common name:
 
* common name:
−
** sn-glycerol 3-phosphate:ubiquinone oxidoreductase
+
** poriferst-7-enol
−
** glycerol-3-phosphate dehydrogenase
+
* molecular weight:
−
* ec number:
+
** 414.713   
−
** [http://enzyme.expasy.org/EC/1.1.5.3 EC-1.1.5.3]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 22-dihydrochondrillasterol
 +
** 24β-ethylcholest-7-en-3β-ol
 +
** chondrillast-7-enol
 +
** dihydrochondrillasterol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-13892]]
−
** 1 [[Ubiquinones]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''=>''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c] '''+''' 1 [[Ubiquinols]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a ubiquinone[c] '''+''' 1 sn-glycerol 3-phosphate[c] '''=>''' 1 glycerone phosphate[c] '''+''' 1 an ubiquinol[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-10_003310]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY-4261]], glycerol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4261 PWY-4261]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-6118]], glycerol-3-phosphate shuttle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6118 PWY-6118]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY0-1561]], glycerol-3-phosphate to cytochrome bo oxidase electron transfer: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1561 PWY0-1561]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY0-1584]], nitrate reduction X (periplasmic, dissimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1584 PWY0-1584]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-6952]], glycerophosphodiester degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6952 PWY-6952]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CAS : 18525-35-4
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28755 28755]
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18977 18977]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12315364 12315364]
−
* LIGAND-RXN:
+
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R00849 R00849]
+
{{#set: inchi key=InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R08657 R08657]
+
{{#set: common name=poriferst-7-enol}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: molecular weight=414.713    }}
−
{{#set: common name=sn-glycerol 3-phosphate:ubiquinone oxidoreductase}}
+
{{#set: common name=22-dihydrochondrillasterol|24β-ethylcholest-7-en-3β-ol|chondrillast-7-enol|dihydrochondrillasterol}}
−
{{#set: common name=glycerol-3-phosphate dehydrogenase}}
+
{{#set: consumed by=RXN-13892}}
−
{{#set: ec number=EC-1.1.5.3}}
+
−
{{#set: gene associated=Ec-10_003310}}
+
−
{{#set: in pathway=PWY-4261|PWY-6118|PWY0-1561|PWY0-1584|PWY-6952}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Revision as of 13:51, 21 March 2018

Metabolite CPD-14901

  • smiles:
    • CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N
  • common name:
    • poriferst-7-enol
  • molecular weight:
    • 414.713
  • Synonym(s):
    • 22-dihydrochondrillasterol
    • 24β-ethylcholest-7-en-3β-ol
    • chondrillast-7-enol
    • dihydrochondrillasterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=2.3.1.97-RXN&oldid=22162"