Difference between revisions of "RXN-2541"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-15_000660 == * Synonym(s): ** Esi_0012_0057 ** Esi0012_0057 == Reactions associated == * DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN ** pantograph...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL] == * smiles: ** CC(C)=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL] == |
| + | * smiles: | ||
| + | ** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=PKEPPDGGTSZLBL-SKCNUYALSA-N | ||
| + | * common name: | ||
| + | ** 5α-cholesta-7,24-dien-3β-ol | ||
| + | * molecular weight: | ||
| + | ** 384.644 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-11887]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459827 5459827] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16290 16290] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05439 C05439] | ||
| + | * HMDB : HMDB06842 | ||
| + | {{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4))))}} | ||
| + | {{#set: inchi key=InChIKey=PKEPPDGGTSZLBL-SKCNUYALSA-N}} | ||
| + | {{#set: common name=5α-cholesta-7,24-dien-3β-ol}} | ||
| + | {{#set: molecular weight=384.644 }} | ||
| + | {{#set: consumed by=RXN-11887}} | ||
Revision as of 13:51, 21 March 2018
Contents
Metabolite 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL
- smiles:
- CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4))))
- inchi key:
- InChIKey=PKEPPDGGTSZLBL-SKCNUYALSA-N
- common name:
- 5α-cholesta-7,24-dien-3β-ol
- molecular weight:
- 384.644
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4))))" cannot be used as a page name in this wiki.
