Difference between revisions of "Ec-07 005200"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORYL-CHOLINE PHOSPHORYL-CHOLINE] == * smiles: ** C[N+](CCOP([O-])([O-])=O)(C)C * inchi ke...") |
(Created page with "Category:Gene == Gene Ec-18_003990 == * left end position: ** 3920927 * transcription direction: ** POSITIVE * right end position: ** 3926679 * centisome position: ** 79.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-18_003990 == |
− | * | + | * left end position: |
− | ** | + | ** 3920927 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3926679 |
− | * | + | * centisome position: |
− | ** | + | ** 79.58757 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0022_0063 |
− | ** | + | ** Esi0022_0063 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[6.3.2.25-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | * | + | == Pathways associated == |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=3920927}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3926679}} | |
− | + | {{#set: centisome position=79.58757 }} | |
− | + | {{#set: common name=Esi_0022_0063|Esi0022_0063}} | |
− | + | {{#set: reaction associated=6.3.2.25-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 13:51, 21 March 2018
Gene Ec-18_003990
- left end position:
- 3920927
- transcription direction:
- POSITIVE
- right end position:
- 3926679
- centisome position:
- 79.58757
- Synonym(s):
- Esi_0022_0063
- Esi0022_0063
Reactions associated
- Reaction: 6.3.2.25-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome