Difference between revisions of "Ec-01 000060"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-36 CPD-36] == * smiles: ** CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2) * inc...")
(Created page with "Category:Gene == Gene Ec-24_004130 == * left end position: ** 4556041 * transcription direction: ** NEGATIVE * right end position: ** 4566280 * centisome position: ** 91.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-36 CPD-36] ==
+
== Gene Ec-24_004130 ==
−
* smiles:
+
* left end position:
−
** CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)
+
** 4556041
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DLGJWSVWTWEWBJ-ZTVLJYEESA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl-D-galactosamine
+
** 4566280
−
* molecular weight:
+
* centisome position:
−
** 378.312    
+
** 91.34605    
 
* Synonym(s):
 
* Synonym(s):
−
** 4-deoxy-Δ4,5-β-D-GlcAp-(1→3)-β-D-GalNAc
+
** Esi_0109_0036
−
** 3-(4-deoxy-α-L-threo-hex-4-enopyranosyluronic acid)-2-acetamido-2-deoxy-D-galactose
+
** Esi0109_0036
−
** 3-(4-deoxy-β-D-gluc-4-enuronosyl)-N-acetyl-D-galactosamine
+
−
** chondroitin disaccharide (unsulfated)
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12178]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4556041}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878429 46878429]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=4566280}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57850 57850]
+
{{#set: centisome position=91.34605   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0109_0036|Esi0109_0036}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01310 C01310]
+
{{#set: reaction associated=ATPASE-RXN}}
−
{{#set: smiles=CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)}}
+
−
{{#set: inchi key=InChIKey=DLGJWSVWTWEWBJ-ZTVLJYEESA-M}}
+
−
{{#set: common name=4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl-D-galactosamine}}
+
−
{{#set: molecular weight=378.312   }}
+
−
{{#set: common name=4-deoxy-Δ4,5-β-D-GlcAp-(1→3)-β-D-GalNAc|3-(4-deoxy-α-L-threo-hex-4-enopyranosyluronic acid)-2-acetamido-2-deoxy-D-galactose|3-(4-deoxy-β-D-gluc-4-enuronosyl)-N-acetyl-D-galactosamine|chondroitin disaccharide (unsulfated)}}
+
−
{{#set: consumed by=RXN-12178}}
+

Revision as of 13:51, 21 March 2018

Gene Ec-24_004130

  • left end position:
    • 4556041
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4566280
  • centisome position:
    • 91.34605
  • Synonym(s):
    • Esi_0109_0036
    • Esi0109_0036

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_000060&oldid=22199"