Difference between revisions of "Ec-00 008360"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == * smiles: ** CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2)) * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Ec-19_000340 == * left end position: ** 457058 * transcription direction: ** POSITIVE * right end position: ** 468384 * centisome position: ** 7.6550...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-19_000340 == |
− | * | + | * left end position: |
− | ** | + | ** 457058 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 468384 |
− | * | + | * centisome position: |
− | ** | + | ** 7.6550303 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0054_0121 |
− | ** | + | ** Esi0054_0121 |
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-9510]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: automated-name-match | |
− | * | + | == Pathways associated == |
− | == | + | * [[PWY-7723]] |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=457058}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=468384}} | |
− | + | {{#set: centisome position=7.6550303 }} | |
− | + | {{#set: common name=Esi_0054_0121|Esi0054_0121}} | |
− | + | {{#set: reaction associated=RXN-9510}} | |
− | + | {{#set: pathway associated=PWY-7723}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 14:51, 21 March 2018
Gene Ec-19_000340
- left end position:
- 457058
- transcription direction:
- POSITIVE
- right end position:
- 468384
- centisome position:
- 7.6550303
- Synonym(s):
- Esi_0054_0121
- Esi0054_0121
Reactions associated
- Reaction: RXN-9510
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome