Difference between revisions of "FORMYL-THF-GLU-N"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-06_002860 == * left end position: ** 2177362 * transcription direction: ** NEGATIVE * right end position: ** 2188392 * centisome position: ** 24.8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == * smiles: ** C[S+](CCC([N+])C(=O)[O-])C * inchi key: ** InChIKey=YDBYJHTYSH...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == |
| − | * | + | * smiles: |
| − | ** | + | ** C[S+](CCC([N+])C(=O)[O-])C |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O |
| − | * | + | * common name: |
| − | ** | + | ** S-methyl-L-methionine |
| − | * | + | * molecular weight: |
| − | ** | + | ** 164.242 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** S-methylmethionine |
| − | + | ||
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[MMUM-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098638 7098638] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58252 58252] |
| − | {{#set: common name= | + | * BIGG : 41336 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03172 C03172] | |
| + | {{#set: smiles=C[S+](CCC([N+])C(=O)[O-])C}} | ||
| + | {{#set: inchi key=InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O}} | ||
| + | {{#set: common name=S-methyl-L-methionine}} | ||
| + | {{#set: molecular weight=164.242 }} | ||
| + | {{#set: common name=S-methylmethionine}} | ||
| + | {{#set: consumed by=MMUM-RXN}} | ||
Revision as of 13:51, 21 March 2018
Contents
Metabolite CPD-397
- smiles:
- C[S+](CCC([N+])C(=O)[O-])C
- inchi key:
- InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O
- common name:
- S-methyl-L-methionine
- molecular weight:
- 164.242
- Synonym(s):
- S-methylmethionine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[S+](CCC([N+])C(=O)[O-])C" cannot be used as a page name in this wiki.
