Difference between revisions of "RXN-17473"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
(Created page with "Category:Gene == Gene Ec-01_004520 == * left end position: ** 3888355 * transcription direction: ** NEGATIVE * right end position: ** 3894406 * centisome position: ** 37.6...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] ==
+
== Gene Ec-01_004520 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
+
** 3888355
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** OPC4-3-hydroxyacyl-CoA
+
** 3894406
−
* molecular weight:
+
* centisome position:
−
** 999.813    
+
** 37.682117    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0018_0199
 +
** Esi0018_0199
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10703]]
+
* Reaction: [[6.3.2.25-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-10705]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3888355}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237301 44237301]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
+
{{#set: right end position=3894406}}
−
{{#set: inchi key=InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J}}
+
{{#set: centisome position=37.682117   }}
−
{{#set: common name=OPC4-3-hydroxyacyl-CoA}}
+
{{#set: common name=Esi_0018_0199|Esi0018_0199}}
−
{{#set: molecular weight=999.813   }}
+
{{#set: reaction associated=6.3.2.25-RXN}}
−
{{#set: consumed by=RXN-10703}}
+
−
{{#set: produced by=RXN-10705}}
+

Revision as of 13:52, 21 March 2018

Gene Ec-01_004520

  • left end position:
    • 3888355
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3894406
  • centisome position:
    • 37.682117
  • Synonym(s):
    • Esi_0018_0199
    • Esi0018_0199

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-17473&oldid=22324"