Difference between revisions of "PYRIDOXKIN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-96 CPD1F-96] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12561 RXN-12561] == * direction: ** REVERSIBLE * common name: ** Thiolase, C-terminal ** Acetyl...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-96 CPD1F-96] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12561 RXN-12561] ==
−
* smiles:
+
* direction:
−
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-L
+
 
* common name:
 
* common name:
−
** gibberellin A19
+
** Thiolase, C-terminal
−
* molecular weight:
+
** Acetyl-CoA acetyltransferase
−
** 360.406   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.9 EC-2.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
−
** GA19
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN1F-168]]
+
** 1 [[ACETYL-COA]][c] '''+''' 1 [[PROPIONYL-COA]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-13534]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 acetyl-CoA[c] '''+''' 1 propanoyl-CoA[c] '''<=>''' 1 coenzyme A[c] '''+''' 1 &beta;-ketovaleryl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-24_000870]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-22_002850]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200921 25200921]
+
{{#set: common name=Thiolase, C-terminal}}
−
* CHEBI:
+
{{#set: common name=Acetyl-CoA acetyltransferase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58587 58587]
+
{{#set: ec number=EC-2.3.1.9}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-24_000870|Ec-22_002850}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02034 C02034]
+
{{#set: in pathway=}}
−
* HMDB : HMDB36896
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: inchi key=InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-L}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=gibberellin A19}}
+
−
{{#set: molecular weight=360.406    }}
+
−
{{#set: common name=GA19}}
+
−
{{#set: produced by=RXN1F-168}}
+

Revision as of 13:52, 21 March 2018

Reaction RXN-12561

  • direction:
    • REVERSIBLE
  • common name:
    • Thiolase, C-terminal
    • Acetyl-CoA acetyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 acetyl-CoA[c] + 1 propanoyl-CoA[c] <=> 1 coenzyme A[c] + 1 β-ketovaleryl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PYRIDOXKIN-RXN&oldid=22332"