Difference between revisions of "RXN-10953"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] == * smiles: ** C(CC(C(=O)[O-])[N+])ONC(N)=O * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FESO3OXI-RXN FESO3OXI-RXN] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * Wi...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FESO3OXI-RXN FESO3OXI-RXN] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[WATER]][c] '''+''' 2 [[FE+3]][c] '''+''' 1 [[SO3]][c] '''<=>''' 1 [[SULFATE]][c] '''+''' 2 [[FE+2]][c] '''+''' 2 [[PROTON]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 H2O[c] '''+''' 2 Fe3+[c] '''+''' 1 sulfite[c] '''<=>''' 1 sulfate[c] '''+''' 2 Fe2+[c] '''+''' 2 H+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[FESULFOX-PWY]], sulfur oxidation II (Fe+3-dependent): [http://metacyc.org/META/NEW-IMAGE?object=FESULFOX-PWY FESULFOX-PWY] | ||
| + | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[gap-filling]] | ||
| + | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
| + | *** Tool: [[meneco]] | ||
| + | **** Comment: [[added for gapfilling]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: in pathway=FESULFOX-PWY}} | |
| − | + | {{#set: reconstruction category=gap-filling}} | |
| − | {{#set: | + | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} |
| − | {{#set: | + | {{#set: reconstruction tool=meneco}} |
| − | {{#set: | + | {{#set: reconstruction comment=added for gapfilling}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 13:52, 21 March 2018
Contents
Reaction FESO3OXI-RXN
- direction:
- REVERSIBLE
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 H2O[c] + 2 Fe3+[c] + 1 sulfite[c] <=> 1 sulfate[c] + 2 Fe2+[c] + 2 H+[c]
Genes associated with this reaction
Pathways
- FESULFOX-PWY, sulfur oxidation II (Fe+3-dependent): FESULFOX-PWY
- 1 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: gap-filling
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
- Tool: meneco
- Comment: added for gapfilling
- Tool: meneco
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
