Difference between revisions of "RXNQT-4142"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLO-THR ALLO-THR] == * common name: ** DL-allothreonine * Synonym(s): ** allothreonine ** allo...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLO-THR ALLO-THR] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] ==
 +
* smiles:
 +
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
 +
* inchi key:
 +
** InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J
 
* common name:
 
* common name:
** DL-allothreonine
+
** XTP
 +
* molecular weight:
 +
** 520.136   
 
* Synonym(s):
 
* Synonym(s):
** allothreonine
+
** xanthosine 5' triphosphate
** allo-thr
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5234]]
+
* [[RXN0-1603]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=DL-allothreonine}}
+
* LIGAND-CPD:
{{#set: common name=allothreonine|allo-thr}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00700 C00700]
{{#set: consumed by=RXN0-5234}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61314 61314]
 +
* BIGG : 35735
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245622 25245622]
 +
* HMDB : HMDB00293
 +
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))}}
 +
{{#set: inchi key=InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J}}
 +
{{#set: common name=XTP}}
 +
{{#set: molecular weight=520.136    }}
 +
{{#set: common name=xanthosine 5' triphosphate}}
 +
{{#set: consumed by=RXN0-1603}}

Revision as of 13:52, 21 March 2018

Metabolite XTP

  • smiles:
    • C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
  • inchi key:
    • InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J
  • common name:
    • XTP
  • molecular weight:
    • 520.136
  • Synonym(s):
    • xanthosine 5' triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))" cannot be used as a page name in this wiki.