Difference between revisions of "Ec-12 001400"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17815 CPD-17815] == * smiles: ** CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Gene == Gene Ec-20_003120 == * left end position: ** 3227044 * transcription direction: ** NEGATIVE * right end position: ** 3235173 * centisome position: ** 62.5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17815 CPD-17815] ==
+
== Gene Ec-20_003120 ==
−
* smiles:
+
* left end position:
−
** CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3227044
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LGTVDWICXIBIOI-UBPKJMQESA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (11Z)-3-oxo-hexadecenoyl-CoA
+
** 3235173
−
* molecular weight:
+
* centisome position:
−
** 1013.883    
+
** 62.583015    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0123_0042
 +
** Esi0123_0042
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[4.2.2.10-RXN]]
−
* [[RXN-16559]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14897]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7243]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3227044}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289728 86289728]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=3235173}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=79021 79021]
+
{{#set: centisome position=62.583015    }}
−
{{#set: smiles=CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0123_0042|Esi0123_0042}}
−
{{#set: inchi key=InChIKey=LGTVDWICXIBIOI-UBPKJMQESA-J}}
+
{{#set: reaction associated=4.2.2.10-RXN|RXN-14897}}
−
{{#set: common name=(11Z)-3-oxo-hexadecenoyl-CoA}}
+
{{#set: pathway associated=PWY-7243}}
−
{{#set: molecular weight=1013.883    }}
+
−
{{#set: produced by=RXN-16559}}
+

Revision as of 13:52, 21 March 2018

Gene Ec-20_003120

  • left end position:
    • 3227044
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3235173
  • centisome position:
    • 62.583015
  • Synonym(s):
    • Esi_0123_0042
    • Esi0123_0042

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_001400&oldid=22396"