Difference between revisions of "ACYL-COA-OXIDASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-14_001310 == * left end position: ** 1295374 * transcription direction: ** POSITIVE * right end position: ** 1313684 * centisome position: ** 19.7...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7107 CPD-7107] == * smiles: ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C * inch...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-14_001310 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7107 CPD-7107] ==
−
* left end position:
+
* smiles:
−
** 1295374
+
** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=KKFIZYKKQLWBKH-UHFFFAOYSA-M
−
* right end position:
+
* common name:
−
** 1313684
+
** diprenylphlorisobutyrophenone
−
* centisome position:
+
* molecular weight:
−
** 19.745266    
+
** 331.431    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0182_0049
+
** deoxycohumulone
−
** Esi0182_0049
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN-7813]]
−
***go-term
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=1295374}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203729 25203729]
−
{{#set: right end position=1313684}}
+
{{#set: smiles=CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C}}
−
{{#set: centisome position=19.745266   }}
+
{{#set: inchi key=InChIKey=KKFIZYKKQLWBKH-UHFFFAOYSA-M}}
−
{{#set: common name=Esi_0182_0049|Esi0182_0049}}
+
{{#set: common name=diprenylphlorisobutyrophenone}}
−
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
+
{{#set: molecular weight=331.431   }}
 +
{{#set: common name=deoxycohumulone}}
 +
{{#set: produced by=RXN-7813}}

Revision as of 14:52, 21 March 2018

Metabolite CPD-7107

  • smiles:
    • CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C
  • inchi key:
    • InChIKey=KKFIZYKKQLWBKH-UHFFFAOYSA-M
  • common name:
    • diprenylphlorisobutyrophenone
  • molecular weight:
    • 331.431
  • Synonym(s):
    • deoxycohumulone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=ACYL-COA-OXIDASE-RXN&oldid=22426"