Difference between revisions of "Ec-12 005070"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6442 CPD-6442] == * smiles: ** COC(C1(C=CC=CC=1O))=O * inchi key: ** InChIKey=OSWPMRLSEDHDF...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5393 RXN0-5393] == * direction: ** LEFT-TO-RIGHT * common name: ** Beta-hydroxydecanoyl thiol...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6442 CPD-6442] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5393 RXN0-5393] ==
−
* smiles:
+
* direction:
−
** COC(C1(C=CC=CC=1O))=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OSWPMRLSEDHDFF-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 1-O-methylsalicylate
+
** Beta-hydroxydecanoyl thiol ester dehydrase, FabA/FabZ
−
* molecular weight:
+
** ClpP/crotonase-like domain
−
** 152.149   
+
** enoyl-Coenzyme A hydratase/3-hydroxyacyl Coenzyme A dehydrogenase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/4.2.1.17 EC-4.2.1.17]
 
* Synonym(s):
 
* Synonym(s):
−
** salicylate methyl ester
 
−
** methyl salicylate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXNQT-4366]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD0-1162]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD0-1163]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 (2E,5Z)-tetradecenoyl-CoA[c] '''+''' 1 H2O[c] '''=>''' 1 (S)-3-hydroxy-(5Z)-tetradecenoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-16_003560]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-16_001250]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-06_001380]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-14_006530]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY0-1337]], oleate β-oxidation: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1337 PWY0-1337]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4133 4133]
+
{{#set: common name=Beta-hydroxydecanoyl thiol ester dehydrase, FabA/FabZ}}
−
* HMDB : HMDB34172
+
{{#set: common name=ClpP/crotonase-like domain}}
−
* LIGAND-CPD:
+
{{#set: common name=enoyl-Coenzyme A hydratase/3-hydroxyacyl Coenzyme A dehydrogenase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C12305 C12305]
+
{{#set: ec number=EC-4.2.1.17}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Ec-16_003560|Ec-16_001250|Ec-06_001380|Ec-14_006530}}
−
** [http://www.chemspider.com/Chemical-Structure.13848808.html 13848808]
+
{{#set: in pathway=PWY0-1337}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31832 31832]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* METABOLIGHTS : MTBLC31832
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=COC(C1(C=CC=CC=1O))=O}}
+
−
{{#set: inchi key=InChIKey=OSWPMRLSEDHDFF-UHFFFAOYSA-N}}
+
−
{{#set: common name=1-O-methylsalicylate}}
+
−
{{#set: molecular weight=152.149    }}
+
−
{{#set: common name=salicylate methyl ester|methyl salicylate}}
+
−
{{#set: consumed by=RXNQT-4366}}
+

Revision as of 13:53, 21 March 2018

Reaction RXN0-5393

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Beta-hydroxydecanoyl thiol ester dehydrase, FabA/FabZ
    • ClpP/crotonase-like domain
    • enoyl-Coenzyme A hydratase/3-hydroxyacyl Coenzyme A dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 (2E,5Z)-tetradecenoyl-CoA[c] + 1 H2O[c] => 1 (S)-3-hydroxy-(5Z)-tetradecenoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-1337, oleate β-oxidation: PWY0-1337
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_005070&oldid=22482"