Difference between revisions of "CPD-4568"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C5 C5] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] == * smiles: ** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O * inchi key: ** InCh...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] == |
* smiles: | * smiles: | ||
− | ** | + | ** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L |
* common name: | * common name: | ||
− | ** | + | ** keto-D-ribose 5-phosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 228.095 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15346]] |
+ | * [[RXN-14997]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21115541 21115541] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58273 58273] |
− | + | {{#set: smiles=[CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O}} | |
− | + | {{#set: inchi key=InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L}} | |
− | + | {{#set: common name=keto-D-ribose 5-phosphate}} | |
− | {{#set: smiles= | + | {{#set: molecular weight=228.095 }} |
− | {{#set: inchi key=InChIKey= | + | {{#set: produced by=RXN-15346|RXN-14997}} |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | + | ||
− | {{#set: produced by= | + |
Revision as of 14:53, 21 March 2018
Contents
Metabolite CPD-15895
- smiles:
- [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O
- inchi key:
- InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L
- common name:
- keto-D-ribose 5-phosphate
- molecular weight:
- 228.095
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.