Difference between revisions of "T2-DECENOYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10855 RXN-10855] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10855 RXN-10855] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 2 [[WATER]][c] '''+''' 1 [[CPD-7682]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''=>''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-468]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 2 H2O[c] '''+''' 1 1-piperideine 6-carboxylate[c] '''+''' 1 NAD(P)+[c] '''=>''' 1 NAD(P)H[c] '''+''' 1 H+[c] '''+''' 1 L-2-aminoadipate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY66-425]], L-lysine degradation II (L-pipecolate pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-425 PWY66-425] | ||
+ | ** '''3''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: in pathway=PWY66-425}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Revision as of 13:53, 21 March 2018
Contents
Reaction RXN-10855
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 WATER[c] + 1 CPD-7682[c] + 1 NAD-P-OR-NOP[c] => 1 NADH-P-OR-NOP[c] + 1 PROTON[c] + 1 CPD-468[c]
- With common name(s):
- 2 H2O[c] + 1 1-piperideine 6-carboxylate[c] + 1 NAD(P)+[c] => 1 NAD(P)H[c] + 1 H+[c] + 1 L-2-aminoadipate[c]
Genes associated with this reaction
Pathways
- PWY66-425, L-lysine degradation II (L-pipecolate pathway): PWY66-425
- 3 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome