Difference between revisions of "CPD-17624"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] == * smiles: ** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InChI...")
(Created page with "Category:Gene == Gene Ec-16_005090 == * left end position: ** 5219590 * transcription direction: ** NEGATIVE * right end position: ** 5225318 * centisome position: ** 97.7...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] ==
+
== Gene Ec-16_005090 ==
−
* smiles:
+
* left end position:
−
** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)
+
** 5219590
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** bupropion
+
** 5225318
−
* molecular weight:
+
* centisome position:
−
** 240.752    
+
** 97.788086    
 
* Synonym(s):
 
* Synonym(s):
−
** (-)-2-(tert-butylamino)-3'-chloropropiophenone
+
** Esi_0334_0012
−
** 1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-
+
** Esi0334_0012
−
** (+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone
+
−
** amfebutamonum
+
−
** α-(tert-butylamino)-m-chloropropiophenone
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-181]]
+
* Reaction: [[ADENYL-KIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-11832]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-12002]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-7913]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7219]]
 +
* [[PWY-7205]]
 +
* [[PWY-7197]]
 +
* [[PWY-7176]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB01156
+
{{#set: left end position=5219590}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24849133 24849133]
+
{{#set: right end position=5225318}}
−
* CHEBI:
+
{{#set: centisome position=97.788086   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3219 3219]
+
{{#set: common name=Esi_0334_0012|Esi0334_0012}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ADENYL-KIN-RXN|RXN-11832|RXN-12002|RXN-7913}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06860 C06860]
+
{{#set: pathway associated=PWY-7219|PWY-7205|PWY-7197|PWY-7176}}
−
* HMDB : HMDB01510
+
−
{{#set: smiles=CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)}}
+
−
{{#set: inchi key=InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O}}
+
−
{{#set: common name=bupropion}}
+
−
{{#set: molecular weight=240.752   }}
+
−
{{#set: common name=(-)-2-(tert-butylamino)-3'-chloropropiophenone|1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-|(+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone|amfebutamonum|α-(tert-butylamino)-m-chloropropiophenone}}
+
−
{{#set: consumed by=RXN66-181}}
+

Revision as of 14:54, 21 March 2018

Gene Ec-16_005090

  • left end position:
    • 5219590
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5225318
  • centisome position:
    • 97.788086
  • Synonym(s):
    • Esi_0334_0012
    • Esi0334_0012

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-17624&oldid=22652"