Difference between revisions of "RXN0-722"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-04_001020 == * left end position: ** 1140662 * transcription direction: ** NEGATIVE * right end position: ** 1143313 * centisome position: ** 17.5...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] == * smiles: ** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InChI...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-04_001020 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] ==
* left end position:
+
* smiles:
** 1140662
+
** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O
* right end position:
+
* common name:
** 1143313
+
** bupropion
* centisome position:
+
* molecular weight:
** 17.51671    
+
** 240.752    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0101_0069
+
** (-)-2-(tert-butylamino)-3'-chloropropiophenone
** Esi0101_0069
+
** 1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-
 +
** (+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone
 +
** amfebutamonum
 +
** α-(tert-butylamino)-m-chloropropiophenone
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[GLYOXII-RXN]]
+
* [[RXN66-181]]
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
***go-term
+
== Reaction(s) of unknown directionality ==
* [[RXN-7919]]
+
** esiliculosus_genome
+
***go-term
+
== Pathways associated ==
+
* [[PWY-5386]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=1140662}}
+
* DRUGBANK : DB01156
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
{{#set: right end position=1143313}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24849133 24849133]
{{#set: centisome position=17.51671   }}
+
* CHEBI:
{{#set: common name=Esi_0101_0069|Esi0101_0069}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3219 3219]
{{#set: reaction associated=GLYOXII-RXN|RXN-7919}}
+
* LIGAND-CPD:
{{#set: pathway associated=PWY-5386}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06860 C06860]
 +
* HMDB : HMDB01510
 +
{{#set: smiles=CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)}}
 +
{{#set: inchi key=InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O}}
 +
{{#set: common name=bupropion}}
 +
{{#set: molecular weight=240.752   }}
 +
{{#set: common name=(-)-2-(tert-butylamino)-3'-chloropropiophenone|1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-|(+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone|amfebutamonum|α-(tert-butylamino)-m-chloropropiophenone}}
 +
{{#set: consumed by=RXN66-181}}

Revision as of 13:54, 21 March 2018

Metabolite CPD-3481

  • smiles:
    • CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)
  • inchi key:
    • InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O
  • common name:
    • bupropion
  • molecular weight:
    • 240.752
  • Synonym(s):
    • (-)-2-(tert-butylamino)-3'-chloropropiophenone
    • 1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-
    • (+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone
    • amfebutamonum
    • α-(tert-butylamino)-m-chloropropiophenone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)" cannot be used as a page name in this wiki.