Difference between revisions of "HOMO-I-CIT"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14736 CPD-14736] == * smiles: ** C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1) * inchi key: ** I...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9557 RXN-9557] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxy-cis-vaccenoyl-[acyl...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14736 CPD-14736] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9557 RXN-9557] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=YGPSJZOEDVAXAB-QMMMGPOBSA-N
+
 
* common name:
 
* common name:
−
** L-kynurenine
+
** 3-hydroxy-cis-vaccenoyl-[acyl-carrier protein] dehydratase
−
* molecular weight:
+
* ec number:
−
** 208.216   
+
** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59]
 
* Synonym(s):
 
* Synonym(s):
−
** kynurenine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[R-3-hydroxy-cis-vaccenoyl-ACPs]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[cis-vaccen-2-enoyl-ACPs]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[2.6.1.7-RXN]]
+
** 1 (R)-3-hydroxy-cis-vacc-11-enoyl-[acp][c] '''=>''' 1 H2O[c] '''+''' 1 a (2-trans-11-cis)-vaccen-2-enoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-5973]], cis-vaccenate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5973 PWY-5973]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
−
* CAS : 343-65-7
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=3-hydroxy-cis-vaccenoyl-[acyl-carrier protein] dehydratase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971029 6971029]
+
{{#set: ec number=EC-4.2.1.59}}
−
* HMDB : HMDB00684
+
{{#set: in pathway=PWY-5973}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=gap-filling}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01718 C01718]
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
−
* CHEBI:
+
{{#set: reconstruction tool=meneco}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57959 57959]
+
{{#set: reconstruction comment=added for gapfilling}}
−
* METABOLIGHTS : MTBLC57959
+
−
{{#set: smiles=C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1)}}
+
−
{{#set: inchi key=InChIKey=YGPSJZOEDVAXAB-QMMMGPOBSA-N}}
+
−
{{#set: common name=L-kynurenine}}
+
−
{{#set: molecular weight=208.216    }}
+
−
{{#set: common name=kynurenine}}
+
−
{{#set: consumed by=KYNURENINE-3-MONOOXYGENASE-RXN}}
+
−
{{#set: reversible reaction associated=2.6.1.7-RXN}}
+

Revision as of 13:54, 21 March 2018

Reaction RXN-9557

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-hydroxy-cis-vaccenoyl-[acyl-carrier protein] dehydratase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-5973, cis-vaccenate biosynthesis: PWY-5973
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

"3-hydroxy-cis-vaccenoyl-[acyl-carrier protein] dehydratase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=HOMO-I-CIT&oldid=22680"