Difference between revisions of "4.2.2.10-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13733 RXN-13733] == * direction: ** REVERSIBLE * common name: ** Ceramidase * ec number: ** [ht...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13733 RXN-13733] ==
−
* smiles:
+
* direction:
−
** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
+
 
* common name:
 
* common name:
−
** dCTP
+
** Ceramidase
−
* molecular weight:
+
* ec number:
−
** 463.127   
+
** [http://enzyme.expasy.org/EC/3.5.1.23 EC-3.5.1.23]
 
* Synonym(s):
 
* Synonym(s):
−
** 2'-deoxycytidine-5'-triphosphate
 
−
** deoxycytidine-triphosphate
 
−
** deoxy-CTP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14216]]
+
* With identifiers:
−
* [[RXN-14198]]
+
** 1 [[CPD3DJ-82]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[Carboxylates]][c] '''+''' 1 [[CPD-13612]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN0-723]]
+
** 1 a dihydroceramide[c] '''+''' 1 H2O[c] '''<=>''' 1 a carboxylate[c] '''+''' 1 D-erythro-sphinganine[c]
−
* [[DCDPKIN-RXN]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-26_006010]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7119]], sphingolipid recycling and degradation (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7119 PWY-7119]
 +
** '''4''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 2056-98-6
+
{{#set: direction=REVERSIBLE}}
−
* PUBCHEM:
+
{{#set: common name=Ceramidase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244665 25244665]
+
{{#set: ec number=EC-3.5.1.23}}
−
* HMDB : HMDB00998
+
{{#set: gene associated=Ec-26_006010}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-7119}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00458 C00458]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481]
+
{{#set: reconstruction tool=pathwaytools}}
−
* BIGG : 35027
+
−
{{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O}}
+
−
{{#set: inchi key=InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J}}
+
−
{{#set: common name=dCTP}}
+
−
{{#set: molecular weight=463.127    }}
+
−
{{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}}
+
−
{{#set: consumed by=RXN-14216|RXN-14198}}
+
−
{{#set: produced by=RXN0-723|DCDPKIN-RXN}}
+

Revision as of 13:54, 21 March 2018

Reaction RXN-13733

  • direction:
    • REVERSIBLE
  • common name:
    • Ceramidase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a dihydroceramide[c] + 1 H2O[c] <=> 1 a carboxylate[c] + 1 D-erythro-sphinganine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7119, sphingolipid recycling and degradation (yeast): PWY-7119
    • 4 reactions found over 11 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=4.2.2.10-RXN&oldid=22713"