Difference between revisions of "RXN-13061"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-147 RXN1F-147] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/5.5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-147 RXN1F-147] ==
−
* smiles:
+
* direction:
−
** C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L
+
** [http://enzyme.expasy.org/EC/5.5.1.18 EC-5.5.1.18]
−
* common name:
+
−
** GDP-β-L-galactose
+
−
* molecular weight:
+
−
** 603.329   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXNQT-4141]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD1F-114]][c] '''<=>''' 1 [[CPD1F-115]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-1882]]
+
** 1 all-trans-lycopene[c] '''<=>''' 1 &delta;-carotene[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-00_005820]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-02_005510]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-00_005850]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-07_007260]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-24_002150]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-24_002140]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-10_006240]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-5946]], &delta;-carotene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5946 PWY-5946]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200538 25200538]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06963 R06963]
−
* CHEBI:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61454 61454]
+
{{#set: ec number=EC-5.5.1.18}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-00_005820|Ec-02_005510|Ec-00_005850|Ec-07_007260|Ec-24_002150|Ec-24_002140|Ec-10_006240}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02280 C02280]
+
{{#set: in pathway=PWY-5946}}
−
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L}}
+
{{#set: reconstruction source=orthology-aragem}}
−
{{#set: common name=GDP-&beta;-L-galactose}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=603.329    }}
+
−
{{#set: consumed by=RXNQT-4141}}
+
−
{{#set: reversible reaction associated=RXN-1882}}
+

Revision as of 13:55, 21 March 2018

Reaction RXN1F-147

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 all-trans-lycopene[c] <=> 1 δ-carotene[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5946, δ-carotene biosynthesis: PWY-5946
    • 1 reactions found over 1 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-13061&oldid=22741"